CAS 57224-63-2 appears in our catalog under these names: Z–Thr–OMe, Z-Thr-OMe, 98%, 98%, Z-Thr-OMe, 99.33%, N-Cbz-L-threonine methyl ester, 95%, Z-Thr-OMe, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 100 g, 500 g, 500g.
Methyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (CAS 57224-63-2) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: methyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: OPZWAOJFQFYYIX-KOLCDFICSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | methyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | OPZWAOJFQFYYIX-KOLCDFICSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)