CAS 98777-34-5 is the registry number for N-Carboxybenzyl-L-allothreonine Methyl Ester. Offered by: TRC. Available pack sizes: 750mg.
Methyl (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (CAS 98777-34-5) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: methyl (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: OPZWAOJFQFYYIX-ONGXEEELSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | methyl (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | OPZWAOJFQFYYIX-ONGXEEELSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)