cas: 100516-54-9 — see every product listed under this CAS number, including other names
(2R,3S)-Benzyl 6-oxo-2,3-diphenylmorpholine-4-carboxylate, 97%, 97% (CAS 100516-54-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11138L-100mg |
| cas | 100516-54-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 549.20 Pln | |
| Chemat | 25g | 1960.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2R,3S)-6-oxo-2,3-diphenylmorpholine-4-carboxylate (CAS 100516-54-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: benzyl (2R,3S)-6-oxo-2,3-diphenylmorpholine-4-carboxylate. InChIKey: HECRUWTZAMPQOS-XZOQPEGZSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | benzyl (2R,3S)-6-oxo-2,3-diphenylmorpholine-4-carboxylate |
| InChIKey | HECRUWTZAMPQOS-XZOQPEGZSA-N |
| SMILES | C1C(=O)O[C@@H]([C@@H](N1C(=O)OCC2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)