cas: 100516-54-9 — see every product listed under this CAS number, including other names
(2R,3S)-N-Cbz-6-oxo-2,3-diphenylmorpholine, 99.19% (CAS 100516-54-9) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 250 mg, 10 g, 25 g, 1 g, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W011024-5 g |
| cas | 100516-54-9 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1007.00 Pln | |
| MedChemExpress | 250 mg | 259.32 Pln | |
| MedChemExpress | 10 g | 1541.06 Pln | |
| MedChemExpress | 25 g | 2962.13 Pln | |
| MedChemExpress | 1 g | 472.94 Pln | |
| MedChemExpress | 500 mg | 347.56 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.19% |
Benzyl (2R,3S)-6-oxo-2,3-diphenylmorpholine-4-carboxylate (CAS 100516-54-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: benzyl (2R,3S)-6-oxo-2,3-diphenylmorpholine-4-carboxylate. InChIKey: HECRUWTZAMPQOS-XZOQPEGZSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | benzyl (2R,3S)-6-oxo-2,3-diphenylmorpholine-4-carboxylate |
| InChIKey | HECRUWTZAMPQOS-XZOQPEGZSA-N |
| SMILES | C1C(=O)O[C@@H]([C@@H](N1C(=O)OCC2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)