cas: 45170-31-8 — see every product listed under this CAS number, including other names
(2S)-2-[[(tert-Butoxy)carbonyl](methyl)amino]-3-methylbutanoic acid, 98.0% (CAS 45170-31-8) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 10 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-41051-100 g |
| cas | 45170-31-8 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 1053.44 Pln | |
| MedChemExpress | 10 g | 240.74 Pln | |
| MedChemExpress | 25 g | 356.84 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 45170-31-8) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: XPUAXAVJMJDPDH-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | XPUAXAVJMJDPDH-QMMMGPOBSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)