CAS 45170-31-8 appears in our catalog under these names: N-Boc-N-methyl-L-valine, >95% (HPLC), Boc–N–Me–Val–OH, Boc-L-MeVal-OH, N-Boc-N-methyl-L-valine, 95% , N-(tert-Butoxycarbonyl)-N-methyl-L-valine, >98.0%(HPLC)(T). Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 5g, 100g, 1000g, 250mg, 10g, 500g.
(2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 45170-31-8) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: XPUAXAVJMJDPDH-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | XPUAXAVJMJDPDH-QMMMGPOBSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)