CAS 13850-91-4 appears in our catalog under these names: Boc-DL-N-Me-Val-OH, 96%, Boc-N-Me-DL-Val-OH, 95+%, Boc-N-Me-DL-Val-OH, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 13850-91-4) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: XPUAXAVJMJDPDH-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | XPUAXAVJMJDPDH-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)