cas: 653589-37-8 — see every product listed under this CAS number, including other names
(2S,4R)-Fmoc-4-hydroxypiperidine-2-carboxylic acid, 98%, 98% (CAS 653589-37-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117SDF-100mg |
| cas | 653589-37-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 1062.80 Pln | |
| Chemat | 1g | 2766.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid (CAS 653589-37-8) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid. InChIKey: CJGSLUBWMLBOFZ-YJYMSZOUSA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid |
| InChIKey | CJGSLUBWMLBOFZ-YJYMSZOUSA-N |
| SMILES | C1CN([C@@H](C[C@@H]1O)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)