CAS 653589-37-8 appears in our catalog under these names: (2S,4R)-Fmoc-4-hydroxypiperidine-2-carboxylic acid, 95%, Fmoc-L-Pip(4-OH)-OH (SR), (2S,4R)-Fmoc-4-hydroxypiperidine-2-carboxylic acid, 98%, 98%, Fmoc-(2S,4R)-4-hydroxypiperidine-2-carboxylic acid, 98%. Offered by: Combi-blocks, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid (CAS 653589-37-8) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid. InChIKey: CJGSLUBWMLBOFZ-YJYMSZOUSA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid |
| InChIKey | CJGSLUBWMLBOFZ-YJYMSZOUSA-N |
| SMILES | C1CN([C@@H](C[C@@H]1O)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)