CAS 2140264-04-4 is the registry number for (2R,3R)-3-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)tetrahydrofuran-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]oxolane-2-carboxylic acid (CAS 2140264-04-4) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (2R,3R)-3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]oxolane-2-carboxylic acid. InChIKey: MVLHNCWDDXIANN-BFUOFWGJSA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2R,3R)-3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]oxolane-2-carboxylic acid |
| InChIKey | MVLHNCWDDXIANN-BFUOFWGJSA-N |
| SMILES | C1CO[C@H]([C@H]1CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)