Products 53164-08-2

CAS 53164-08-2 is the registry number for Acemetacin Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2-oxo-2-phenylmethoxyethyl) 2-(5-methoxy-2-methyl-1H-indol-3-yl)acetate (CAS 53164-08-2) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (2-oxo-2-phenylmethoxyethyl) 2-(5-methoxy-2-methyl-1H-indol-3-yl)acetate. InChIKey: UPQHZULEKGENIL-UHFFFAOYSA-N.

Identity
Molecular formulaC21H21NO5
Molecular weight367.4 g/mol
IUPAC name(2-oxo-2-phenylmethoxyethyl) 2-(5-methoxy-2-methyl-1H-indol-3-yl)acetate
InChIKeyUPQHZULEKGENIL-UHFFFAOYSA-N
SMILESCC1=C(C2=C(N1)C=CC(=C2)OC)CC(=O)OCC(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)