CAS 285996-72-7 appears in our catalog under these names: 4–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)tetrahydro–2H–pyran–4–carboxylic acid, Fmoc-ThpGly-OH, Fmoc-4-amino-tetrahydropyran-4-carboxylic acid, Fmoc-ThpGly-OH 95%, 4-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]tetrahydro-2H-pyran-4-carboxylic acid, 98%, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 1g, 250mg, 25g, 5g, 500mg, 1000mg, 5000mg.
4-(9H-fluoren-9-ylmethoxycarbonylamino)oxane-4-carboxylic acid (CAS 285996-72-7) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)oxane-4-carboxylic acid. InChIKey: FBTUQOKQROVXAO-UHFFFAOYSA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)oxane-4-carboxylic acid |
| InChIKey | FBTUQOKQROVXAO-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)