Products 917099-02-6
CAS 917099-02-6 appears in our catalog under these names: (2R,4S)-Fmoc-4-hydroxypiperidine-2-carboxylic acid, 95%, rel-1-(9H-Fluoren-9-ylmethyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 1g, 250mg.
(2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid (CAS 917099-02-6) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid. InChIKey: CJGSLUBWMLBOFZ-ORAYPTAESA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid |
| InChIKey | CJGSLUBWMLBOFZ-ORAYPTAESA-N |
| SMILES | C1CN([C@H](C[C@H]1O)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)