CAS 191793-75-6 is the registry number for 1-((9H-Fluoren-9-yl)methyl) 2-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 191793-75-6) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: 1-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: AWCMBJJPVSUPSS-DJJJIMSYSA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 1-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | AWCMBJJPVSUPSS-DJJJIMSYSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)