(3,4-Dihydro-2H-benzo[b][1,4]dioxepin-6-yl)boronic acid 95%
cas: 1107064-09-4 — see every product listed under this CAS number, including other names
(3,4-Dihydro-2H-benzo[b][1,4]dioxepin-6-yl)boronic acid 95% (CAS 1107064-09-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A860625-250mg |
| cas | 1107064-09-4 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 937.75 Pln | |
| Ambeed | 5g | 3118.25 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A860625 |
3,4-dihydro-2H-1,5-benzodioxepin-6-ylboronic acid (CAS 1107064-09-4) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepin-6-ylboronic acid. InChIKey: BTDVUENZZYXXFN-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,5-benzodioxepin-6-ylboronic acid |
| InChIKey | BTDVUENZZYXXFN-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)OCCCO2)(O)O |
Computed by PubChem (NCBI)