CAS 2121511-41-7 is the registry number for (2,5-Dichloro-3-fluorophenyl)boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2,5-dichloro-3-fluorophenyl)boronic acid (CAS 2121511-41-7) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (2,5-dichloro-3-fluorophenyl)boronic acid. InChIKey: VLKZUOKRWNZSPW-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (2,5-dichloro-3-fluorophenyl)boronic acid |
| InChIKey | VLKZUOKRWNZSPW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1Cl)F)Cl)(O)O |
Computed by PubChem (NCBI)