Products 1451392-99-6
CAS 1451392-99-6 appears in our catalog under these names: (2,6-Dichloro-4-fluorophenyl)boronic acid, 95%, 2,6-Dichloro-4-fluorophenylboronic acid, >95% (HPLC), 2,6-Dichloro-4-fluorophenylboronic acid, (2,6-Dichloro-4-fluorophenyl)boronic acid 97%, B-(2,6-Dichloro-4-fluorophenyl)boronic acid, 97%, 97%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 500mg, 0,5g, 5g, 100mg.
(2,6-dichloro-4-fluorophenyl)boronic acid (CAS 1451392-99-6) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (2,6-dichloro-4-fluorophenyl)boronic acid. InChIKey: KXQQDVRYPXXJCR-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (2,6-dichloro-4-fluorophenyl)boronic acid |
| InChIKey | KXQQDVRYPXXJCR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)F)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,6-dichloro-4-fluorophenyl)boronic acid, B-(2,6-Dichloro-4-fluorophenyl)boronic acid, 2,6-Dichloro-4-fluorophenylboronic acid, 2,6-Dichloro-4-fluorobenzeneboronic acid, (2,6-Dichloro-4-fluoro-phenyl)boronic acid, KXQQDVRYPXXJCR-UHFFFAOYSA-N, (2,6-dichloro-4-fluorophenyl)boronicacid, Boronic acid, B-(2,6-dichloro-4-fluorophenyl)-, (2,6-Dichloro-4-fluorophenyl)boronic acid - [D88746]