Products 2828433-43-6
CAS 2828433-43-6 appears in our catalog under these names: 2,3-Dichloro-5-fluorophenylboronic acid, 97%, 97%, B-(2,3-Dichloro-5-fluorophenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
(2,3-dichloro-5-fluorophenyl)boronic acid (CAS 2828433-43-6) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (2,3-dichloro-5-fluorophenyl)boronic acid. InChIKey: HMGDRCAPOJWDJP-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (2,3-dichloro-5-fluorophenyl)boronic acid |
| InChIKey | HMGDRCAPOJWDJP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1Cl)Cl)F)(O)O |
Computed by PubChem (NCBI)