cas: 1190989-09-3 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-(Methoxycarbonyl)Phenyl)Boronic Acid, 98%, 98% (CAS 1190989-09-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111I7B-100mg |
| cas | 1190989-09-3 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 923.60 Pln | |
| Chemat | 100g | 13394.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,5-difluoro-4-methoxycarbonylphenyl)boronic acid (CAS 1190989-09-3) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (3,5-difluoro-4-methoxycarbonylphenyl)boronic acid. InChIKey: DFSQCSAZKURRRE-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (3,5-difluoro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | DFSQCSAZKURRRE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)