cas: 1132666-81-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-hydroxyphenyl)boronic acid 98% (CAS 1132666-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A687405-100mg |
| cas | 1132666-81-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2333.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A687405 |
(3,5-difluoro-4-hydroxyphenyl)boronic acid (CAS 1132666-81-9) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (3,5-difluoro-4-hydroxyphenyl)boronic acid. InChIKey: ZLSDOFHBADFRMF-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (3,5-difluoro-4-hydroxyphenyl)boronic acid |
| InChIKey | ZLSDOFHBADFRMF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)O)F)(O)O |
Computed by PubChem (NCBI)