cas: 1132666-81-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-hydroxyphenyl)boronic acid, 98+%, 98+% (CAS 1132666-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118SRG-100mg |
| cas | 1132666-81-9 |
| size | 100mg |
| availability | 1.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 500mg | 275.60 Pln | |
| Chemat | 1g | 472.40 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
(3,5-difluoro-4-hydroxyphenyl)boronic acid (CAS 1132666-81-9) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (3,5-difluoro-4-hydroxyphenyl)boronic acid. InChIKey: ZLSDOFHBADFRMF-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (3,5-difluoro-4-hydroxyphenyl)boronic acid |
| InChIKey | ZLSDOFHBADFRMF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)O)F)(O)O |
Computed by PubChem (NCBI)