cas: 1132666-81-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-hydroxyphenyl)boronic acid, 97% (CAS 1132666-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F437056-100MG |
| cas | 1132666-81-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1950.37 Pln | |
| Fluorochem | 10g | 3845.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3,5-difluoro-4-hydroxyphenyl)boronic acid (CAS 1132666-81-9) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (3,5-difluoro-4-hydroxyphenyl)boronic acid. InChIKey: ZLSDOFHBADFRMF-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (3,5-difluoro-4-hydroxyphenyl)boronic acid |
| InChIKey | ZLSDOFHBADFRMF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)O)F)(O)O |
Computed by PubChem (NCBI)