cas: 1451390-93-4 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-isopropoxyphenyl)boronic acid, 98% (CAS 1451390-93-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A443681-25g |
| cas | 1451390-93-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 6417.25 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 1451390-93-4) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: SHSBRMCUHPYPIR-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | SHSBRMCUHPYPIR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)