cas: 1621332-09-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-methylphenyl)boronic acid, 97% (CAS 1621332-09-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F610850-250MG |
| cas | 1621332-09-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 591.48 Pln | |
| Fluorochem | 5g | 1575.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3,5-difluoro-4-methylphenyl)boronic acid (CAS 1621332-09-9) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (3,5-difluoro-4-methylphenyl)boronic acid. InChIKey: PVWCCYIZIZXRFE-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (3,5-difluoro-4-methylphenyl)boronic acid |
| InChIKey | PVWCCYIZIZXRFE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C)F)(O)O |
Computed by PubChem (NCBI)