CAS 1884277-68-2 appears in our catalog under these names: (3,6-difluoro-2-methylphenyl)boronic acid, 95%, (3,6-Difluoro-2-methylphenyl)boronic acid, ≥95%, 2,5-Difluoro-6-methylphenylboronic acid, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
(3,6-difluoro-2-methylphenyl)boronic acid (CAS 1884277-68-2) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (3,6-difluoro-2-methylphenyl)boronic acid. InChIKey: UZQGKRUEUBRDFE-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (3,6-difluoro-2-methylphenyl)boronic acid |
| InChIKey | UZQGKRUEUBRDFE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1C)F)F)(O)O |
Computed by PubChem (NCBI)