Products 1586045-40-0

CAS 1586045-40-0 appears in our catalog under these names: 2,6-Difluoro-3-methylphenylboronic acid, 98%, 2,6-Difluoro-3-methylphenylboronic acid 98%, 2,6-Difluoro-3-methylphenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g.

Structural formula: {0} (CAS {1})

(2,6-difluoro-3-methylphenyl)boronic acid (CAS 1586045-40-0) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (2,6-difluoro-3-methylphenyl)boronic acid. InChIKey: LYEXPRVYGCOGMB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BF2O2
Molecular weight171.94 g/mol
IUPAC name(2,6-difluoro-3-methylphenyl)boronic acid
InChIKeyLYEXPRVYGCOGMB-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)C)F)(O)O

Computed by PubChem (NCBI)