CAS 1621332-09-9 appears in our catalog under these names: 3,5-Difluoro-4-methylphenylboronic acid, 95%, 3,5–Difluoro–4–methylphenylboronic acid, 3,5-Difluoro-4-methylphenylboronic acid, 95%, 95%, (3,5-Difluoro-4-methylphenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3,5-difluoro-4-methylphenyl)boronic acid (CAS 1621332-09-9) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (3,5-difluoro-4-methylphenyl)boronic acid. InChIKey: PVWCCYIZIZXRFE-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (3,5-difluoro-4-methylphenyl)boronic acid |
| InChIKey | PVWCCYIZIZXRFE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C)F)(O)O |
Computed by PubChem (NCBI)