CAS 2246867-26-3 appears in our catalog under these names: 2,6-Difluoro-4-methylphenylboronic acid, 98%, (2,6-difluoro-4-methylphenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2,6-difluoro-4-methylphenyl)boronic acid (CAS 2246867-26-3) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (2,6-difluoro-4-methylphenyl)boronic acid. InChIKey: GMJSBVBNJNOXGT-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (2,6-difluoro-4-methylphenyl)boronic acid |
| InChIKey | GMJSBVBNJNOXGT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C)F)(O)O |
Computed by PubChem (NCBI)