CAS 1416244-48-8 appears in our catalog under these names: 4,5-Difluoro-2-methylphenylboronic acid, 98%, (4,5–Difluoro–2–methylphenyl)boronic acid, (4,5-Difluoro-2-methylphenyl)boronic acid 97%, (4,5-Difluoro-2-methylphenyl)boronic acid, 98%, 98%, (4,5-Difluoro-2-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(4,5-difluoro-2-methylphenyl)boronic acid (CAS 1416244-48-8) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (4,5-difluoro-2-methylphenyl)boronic acid. InChIKey: RUSKIGNGLQRANK-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (4,5-difluoro-2-methylphenyl)boronic acid |
| InChIKey | RUSKIGNGLQRANK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)F)F)(O)O |
Computed by PubChem (NCBI)