CAS 2246751-44-8 is the registry number for [(3,4-Difluorophenyl)methyl]boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(3,4-difluorophenyl)methylboronic acid (CAS 2246751-44-8) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (3,4-difluorophenyl)methylboronic acid. InChIKey: VHKRQHBIQDLANB-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (3,4-difluorophenyl)methylboronic acid |
| InChIKey | VHKRQHBIQDLANB-UHFFFAOYSA-N |
| SMILES | B(CC1=CC(=C(C=C1)F)F)(O)O |
Computed by PubChem (NCBI)