(3,5-Difluoro-4-propoxyphenyl)boronic acid 97%
cas: 2096331-43-8 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-propoxyphenyl)boronic acid 97% (CAS 2096331-43-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A363125-100mg |
| cas | 2096331-43-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 431.56 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 25g | 3841.38 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A363125 |
(3,5-difluoro-4-propoxyphenyl)boronic acid (CAS 2096331-43-8) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (3,5-difluoro-4-propoxyphenyl)boronic acid. InChIKey: NGMFHAGRFNZKKZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (3,5-difluoro-4-propoxyphenyl)boronic acid |
| InChIKey | NGMFHAGRFNZKKZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OCCC)F)(O)O |
Computed by PubChem (NCBI)