(3-(Chlorocarbonyl)phenyl)boronic acid, 90%
cas: 332154-58-2 — see every product listed under this CAS number, including other names
(3-(Chlorocarbonyl)phenyl)boronic acid, 90% (CAS 332154-58-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A784904-5g |
| cas | 332154-58-2 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 915.50 Pln | |
| Ambeed | 10g | 1605.25 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 364.34 Pln | |
| BLDpharm | 5g | 980.79 Pln | |
| BLDpharm | 10g | 1724.97 Pln | |
| BLDpharm | 25g | 3335.52 Pln | |
| Fluorochem | 1g | 653.95 Pln | |
| Fluorochem | 5g | 2054.50 Pln | |
| Fluorochem | 25g | 5959.38 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
(3-carbonochloridoylphenyl)boronic acid (CAS 332154-58-2) is a chemical compound with the molecular formula C7H6BClO3 and a molecular weight of 184.39 g/mol. IUPAC name: (3-carbonochloridoylphenyl)boronic acid. InChIKey: AIHGXUQQIIYAJP-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO3 |
|---|---|
| Molecular weight | 184.39 g/mol |
| IUPAC name | (3-carbonochloridoylphenyl)boronic acid |
| InChIKey | AIHGXUQQIIYAJP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Chlorocarbonylphenylboronic Acid, (3-(Chlorocarbonyl)phenyl)boronic acid, Benzoylchloride-3-boronic acid, (3-carbonochloridoylphenyl)boronic acid, (3-chlorocarbonylphenyl)boronic acid, [3-(Chlorocarbonyl)phenyl]boronic acid, 3-(Chlorocarbonyl)phenylboronic Acid, [3-(carbonochloridoyl)phenyl]boronic acid, Boronic acid, [3-(chlorocarbonyl)phenyl]- (9CI), (3-(Chlorocarbonyl)phenyl)boronicacid