Products 2572469-70-4
CAS 2572469-70-4 appears in our catalog under these names: (2-Chloro-6-formylphenyl)boronic acid 95%, (2-Chloro-6-formylphenyl)boronic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-chloro-6-formylphenyl)boronic acid (CAS 2572469-70-4) is a chemical compound with the molecular formula C7H6BClO3 and a molecular weight of 184.39 g/mol. IUPAC name: (2-chloro-6-formylphenyl)boronic acid. InChIKey: GJILNQSDSPVHPO-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO3 |
|---|---|
| Molecular weight | 184.39 g/mol |
| IUPAC name | (2-chloro-6-formylphenyl)boronic acid |
| InChIKey | GJILNQSDSPVHPO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1Cl)C=O)(O)O |
Computed by PubChem (NCBI)