Products 870238-36-1
CAS 870238-36-1 appears in our catalog under these names: 5-Chloro-2-formylphenylboronic acid, 95-<97%, 5-Chloro-2-formylphenylboronic acid, ≥97-<99%, 5–Chloro–2–formylphenylboronic acid, 5-Chloro-2-formylphenylboronic acid 95%, 5-Chloro-2-formylphenylboronic acid, 95%, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 1g, 250mg.
(5-chloro-2-formylphenyl)boronic acid (CAS 870238-36-1) is a chemical compound with the molecular formula C7H6BClO3 and a molecular weight of 184.39 g/mol. IUPAC name: (5-chloro-2-formylphenyl)boronic acid. InChIKey: LVNPJTSTUBPCMK-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO3 |
|---|---|
| Molecular weight | 184.39 g/mol |
| IUPAC name | (5-chloro-2-formylphenyl)boronic acid |
| InChIKey | LVNPJTSTUBPCMK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C=O)(O)O |
Computed by PubChem (NCBI)