Products 1150114-78-5
CAS 1150114-78-5 appears in our catalog under these names: 2-Chloro-5-formylphenylboronic acid, 96%, (2-Chloro-5-formylphenyl)boronic acid 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg.
(2-chloro-5-formylphenyl)boronic acid (CAS 1150114-78-5) is a chemical compound with the molecular formula C7H6BClO3 and a molecular weight of 184.39 g/mol. IUPAC name: (2-chloro-5-formylphenyl)boronic acid. InChIKey: BGTXLDYEFFSFNR-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO3 |
|---|---|
| Molecular weight | 184.39 g/mol |
| IUPAC name | (2-chloro-5-formylphenyl)boronic acid |
| InChIKey | BGTXLDYEFFSFNR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C=O)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-5-formylphenylboronic acid, (2-chloro-5-formylphenyl)boronic acid, 2-Chloro-5-formylbenzeneboronic acid, (2-Chloro-5-formylphenyl)boronicacid, BGTXLDYEFFSFNR-UHFFFAOYSA-N, 2-Chloro-5-formylphenylboronic acid (contains varying amounts of Anhydride), (2-Chloro-5-formylphenyl)boronic acid(contains varying amounts of Anhydride)