cas: 850567-23-6 — see every product listed under this CAS number, including other names
(3-(Cyclopropylcarbamoyl)phenyl)boronic acid, 98% (CAS 850567-23-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A570759-25g |
| cas | 850567-23-6 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 4809.28 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 789.32 Pln | |
| Fluorochem | 25g | 3715.38 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[3-(cyclopropylcarbamoyl)phenyl]boronic acid (CAS 850567-23-6) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: [3-(cyclopropylcarbamoyl)phenyl]boronic acid. InChIKey: ACYLEYDBPWXTIO-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | [3-(cyclopropylcarbamoyl)phenyl]boronic acid |
| InChIKey | ACYLEYDBPWXTIO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2CC2)(O)O |
Computed by PubChem (NCBI)