cas: 2377608-77-8 — see every product listed under this CAS number, including other names
(3-Chloro-2-fluoro-4-methylphenyl)boronic acid, ≥95%, ≥95% (CAS 2377608-77-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JRUA-1g |
| cas | 2377608-77-8 |
| size | 1g |
| availability | 1876g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1154.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(3-chloro-2-fluoro-4-methylphenyl)boronic acid (CAS 2377608-77-8) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (3-chloro-2-fluoro-4-methylphenyl)boronic acid. InChIKey: ZSJCOQVNSALFEJ-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (3-chloro-2-fluoro-4-methylphenyl)boronic acid |
| InChIKey | ZSJCOQVNSALFEJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C)Cl)F)(O)O |
Computed by PubChem (NCBI)