cas: 2121512-87-4 — see every product listed under this CAS number, including other names
(3-Chloro-5-(hydroxymethyl)phenyl)boronic acid, 97%, 97% (CAS 2121512-87-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHGC-100mg |
| cas | 2121512-87-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 10g | 1485.20 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 861.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[3-chloro-5-(hydroxymethyl)phenyl]boronic acid (CAS 2121512-87-4) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: [3-chloro-5-(hydroxymethyl)phenyl]boronic acid. InChIKey: GAIOEGMKZDBACM-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | [3-chloro-5-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | GAIOEGMKZDBACM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)CO)(O)O |
Computed by PubChem (NCBI)