cas: 187804-79-1 — see every product listed under this CAS number, including other names
(3-Fluoro-4-(trifluoromethoxy)phenyl)boronic acid 97% (CAS 187804-79-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104488-100mg |
| cas | 187804-79-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 837.62 Pln | |
| Ambeed | 10g | 1538.50 Pln | |
| Ambeed | 25g | 2584.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A104488 |
[3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid (CAS 187804-79-1) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: [3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: VDEVIIGZNWVCOR-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | [3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | VDEVIIGZNWVCOR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)