(3-Methoxynaphthalen-1-yl)boronic acid, 95%
cas: 219834-94-3 — see every product listed under this CAS number, including other names
(3-Methoxynaphthalen-1-yl)boronic acid, 95% (CAS 219834-94-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A109450-250mg |
| cas | 219834-94-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1594.12 Pln | |
| Ambeed | 10g | 2973.62 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 480.97 Pln | |
| BLDpharm | 5g | 1713.87 Pln | |
| BLDpharm | 10g | 3202.23 Pln | |
| Fluorochem | 10g | 3048.94 Pln | |
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 461.31 Pln | |
| Fluorochem | 5g | 1632.78 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(3-methoxynaphthalen-1-yl)boronic acid (CAS 219834-94-3) is a chemical compound with the molecular formula C11H11BO3 and a molecular weight of 202.02 g/mol. IUPAC name: (3-methoxynaphthalen-1-yl)boronic acid. InChIKey: SEIWXMRNVBLGPH-UHFFFAOYSA-N.
| Molecular formula | C11H11BO3 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | (3-methoxynaphthalen-1-yl)boronic acid |
| InChIKey | SEIWXMRNVBLGPH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC2=CC=CC=C12)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-Methoxynaphthalen-1-yl)boronic acid, 3-Methoxy-1-naphthaleneboronic acid, 2-Methoxynaphthalene-4-boronic acid, 3-Methoxynaphthalene-1-boronic acid, 3-Methoxynaphthalen-1-yl)boronic acid, (3-Methoxyna, (3-Methoxynaphthalen-1-yl)boronicacid, (3-methoxy-1-naphthyl)boronic acid, (3-Methoxynaphthalen-1-yl)boronic acid(contains varying amounts of Anhydride)