Products 104116-17-8
CAS 104116-17-8 appears in our catalog under these names: 2–Methoxynaphthalene–1–boronic acid, 2-Methoxy-1-naphthaleneboronic acid, 98%, 98%, (2-Methoxynaphthalen-1-yl)boronic acid, 97%, 2-Methoxy-1-naphthaleneboronic acid 98%, 2-Methoxy-1-naphthaleneboronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 250mg, 1g, 100g, 500g, 10g, 250g.
2-Methoxy-1-naphthaleneboronic acid, 98%, 98%
Chemat- size: 250mg, 1g, 5g, 25g
- Variants: 9
from 74.00
(2-methoxynaphthalen-1-yl)boronic acid (CAS 104116-17-8) is a chemical compound with the molecular formula C11H11BO3 and a molecular weight of 202.02 g/mol. IUPAC name: (2-methoxynaphthalen-1-yl)boronic acid. InChIKey: NHVWTZOWDLOBBS-UHFFFAOYSA-N.
| Molecular formula | C11H11BO3 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | (2-methoxynaphthalen-1-yl)boronic acid |
| InChIKey | NHVWTZOWDLOBBS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC2=CC=CC=C12)OC)(O)O |
Computed by PubChem (NCBI)