Products 219834-94-3
CAS 219834-94-3 appears in our catalog under these names: (3–Methoxynaphthalen–1–yl)boronic acid, (3-Methoxynaphthalen-1-yl)boronic acid 95%, (3-Methoxynaphthalen-1-yl)boronic acid, 95%, (3-Methoxynaphthalen-1-yl)boronic acid, 97%, 97%, 2-Methoxynaphthalene-4-boronic acid, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
(3-methoxynaphthalen-1-yl)boronic acid (CAS 219834-94-3) is a chemical compound with the molecular formula C11H11BO3 and a molecular weight of 202.02 g/mol. IUPAC name: (3-methoxynaphthalen-1-yl)boronic acid. InChIKey: SEIWXMRNVBLGPH-UHFFFAOYSA-N.
| Molecular formula | C11H11BO3 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | (3-methoxynaphthalen-1-yl)boronic acid |
| InChIKey | SEIWXMRNVBLGPH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC2=CC=CC=C12)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-Methoxynaphthalen-1-yl)boronic acid, 3-Methoxy-1-naphthaleneboronic acid, 2-Methoxynaphthalene-4-boronic acid, 3-Methoxynaphthalene-1-boronic acid, 3-Methoxynaphthalen-1-yl)boronic acid, (3-Methoxyna, (3-Methoxynaphthalen-1-yl)boronicacid, (3-methoxy-1-naphthyl)boronic acid, (3-Methoxynaphthalen-1-yl)boronic acid(contains varying amounts of Anhydride)