Products 1946843-21-5
CAS 1946843-21-5 is the registry number for 6-(Hydroxymethyl)naphthalene-2-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[6-(hydroxymethyl)naphthalen-2-yl]boronic acid (CAS 1946843-21-5) is a chemical compound with the molecular formula C11H11BO3 and a molecular weight of 202.02 g/mol. IUPAC name: [6-(hydroxymethyl)naphthalen-2-yl]boronic acid. InChIKey: QDRGXVPUGZYLOR-UHFFFAOYSA-N.
| Molecular formula | C11H11BO3 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | [6-(hydroxymethyl)naphthalen-2-yl]boronic acid |
| InChIKey | QDRGXVPUGZYLOR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)CO)(O)O |
Computed by PubChem (NCBI)