Products 1630264-42-4
CAS 1630264-42-4 appears in our catalog under these names: 2-Methoxynaphthalene-5-boronic acid, 98%, 2-Methoxynaphthalene-5-boronic acid 95%, 2-Methoxynaphthalene-5-boronic acid, 95%, 95%, 2-Methoxynaphthalene-5-boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(6-methoxynaphthalen-1-yl)boronic acid (CAS 1630264-42-4) is a chemical compound with the molecular formula C11H11BO3 and a molecular weight of 202.02 g/mol. IUPAC name: (6-methoxynaphthalen-1-yl)boronic acid. InChIKey: CBIYQHHNRCPDIG-UHFFFAOYSA-N.
| Molecular formula | C11H11BO3 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | (6-methoxynaphthalen-1-yl)boronic acid |
| InChIKey | CBIYQHHNRCPDIG-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC(=CC2=CC=C1)OC)(O)O |
Computed by PubChem (NCBI)