CAS 2096339-58-9 is the registry number for 4–(2–Tolyl)furan–2–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[4-(2-methylphenyl)furan-2-yl]boronic acid (CAS 2096339-58-9) is a chemical compound with the molecular formula C11H11BO3 and a molecular weight of 202.02 g/mol. IUPAC name: [4-(2-methylphenyl)furan-2-yl]boronic acid. InChIKey: PURPXNGGMOYHIA-UHFFFAOYSA-N.
| Molecular formula | C11H11BO3 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | [4-(2-methylphenyl)furan-2-yl]boronic acid |
| InChIKey | PURPXNGGMOYHIA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CO1)C2=CC=CC=C2C)(O)O |
Computed by PubChem (NCBI)