CAS 252670-79-4 appears in our catalog under these names: (1-Methoxynaphthalen-2-yl)boronic acid 98%, (1-Methoxynaphthalen-2-yl)boronic Acid, 98%, 98%, (1-METHOXYNAPHTHALEN-2-YL)BORONIC ACID, 99%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 50g, 10g.
(1-methoxynaphthalen-2-yl)boronic acid (CAS 252670-79-4) is a chemical compound with the molecular formula C11H11BO3 and a molecular weight of 202.02 g/mol. IUPAC name: (1-methoxynaphthalen-2-yl)boronic acid. InChIKey: AKLWQLDKPYSCMT-UHFFFAOYSA-N.
| Molecular formula | C11H11BO3 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | (1-methoxynaphthalen-2-yl)boronic acid |
| InChIKey | AKLWQLDKPYSCMT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C2=CC=CC=C2C=C1)OC)(O)O |
Computed by PubChem (NCBI)