cas: 180146-66-1 — see every product listed under this CAS number, including other names
(3-Nitro-5-(trifluoromethyl)phenyl)methanol 97% (CAS 180146-66-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A279830-250mg |
| cas | 180146-66-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1188.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A279830 |
[3-nitro-5-(trifluoromethyl)phenyl]methanol (CAS 180146-66-1) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: [3-nitro-5-(trifluoromethyl)phenyl]methanol. InChIKey: WSIIHVBSVSJXMQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | [3-nitro-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | WSIIHVBSVSJXMQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)