cas: 172695-33-9 — see every product listed under this CAS number, including other names
(3R)-3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-methylpentanoic acid, 98%, 98% (CAS 172695-33-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145Y1-100mg |
| cas | 172695-33-9 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 933.20 Pln | |
| Chemat | 10g | 1365.20 Pln | |
| Chemat | 25g | 2800.40 Pln | |
| Chemat | 100g | 8646.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid (CAS 172695-33-9) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid. InChIKey: KFDMTAMWOIQTOB-LJQANCHMSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid |
| InChIKey | KFDMTAMWOIQTOB-LJQANCHMSA-N |
| SMILES | CC(C)[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)