CAS 103478-58-6 appears in our catalog under these names: Fmoc-N-methyl-D-valine, 97%, Fmoc–D–N– Me–Val–OH, Fmoc-D-MeVal-OH, Fmoc-D-N-Me-Val-OH, 97%, 97%, Fmoc-D-N-Me-Val-OH, 99.78%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 1g, 10g, 25g, 5g, 100g, 25 g, 5 g, 10 g.
(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoic acid (CAS 103478-58-6) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoic acid. InChIKey: YCXXXPZNQXXRIG-LJQANCHMSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoic acid |
| InChIKey | YCXXXPZNQXXRIG-LJQANCHMSA-N |
| SMILES | CC(C)[C@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)