Products 1820615-61-9

CAS 1820615-61-9 is the registry number for methyl 3-methoxy-5-{4-[(piperidin-1-yl)carbonyl]phenyl}benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-methoxy-5-[4-(piperidine-1-carbonyl)phenyl]benzoate (CAS 1820615-61-9) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: methyl 3-methoxy-5-[4-(piperidine-1-carbonyl)phenyl]benzoate. InChIKey: SZAKKACTLLKKJA-UHFFFAOYSA-N.

Identity
Molecular formulaC21H23NO4
Molecular weight353.4 g/mol
IUPAC namemethyl 3-methoxy-5-[4-(piperidine-1-carbonyl)phenyl]benzoate
InChIKeySZAKKACTLLKKJA-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1)C(=O)OC)C2=CC=C(C=C2)C(=O)N3CCCCC3

Computed by PubChem (NCBI)